EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23NO3 |
| Net Charge | 0 |
| Average Mass | 265.353 |
| Monoisotopic Mass | 265.16779 |
| SMILES | C=CCOc1ccccc1OC[C@@H](O)CNC(C)C |
| InChI | InChI=1S/C15H23NO3/c1-4-9-18-14-7-5-6-8-15(14)19-11-13(17)10-16-12(2)3/h4-8,12-13,16-17H,1,9-11H2,2-3H3/t13-/m0/s1 |
| InChIKey | CEMAWMOMDPGJMB-ZDUSSCGKSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-oxprenolol (CHEBI:747561) is a 1-(propan-2-ylamino)-3-(2-prop-2-enoxyphenoxy)-2-propanol (CHEBI:91704) |
| (S)-oxprenolol (CHEBI:747561) is conjugate base of (S)-oxprenolol(1+) (CHEBI:747615) |
| (S)-oxprenolol (CHEBI:747561) is enantiomer of (R)-oxprenolol (CHEBI:747560) |
| Incoming Relation(s) |
| oxprenolol (CHEBI:747559) has part (S)-oxprenolol (CHEBI:747561) |
| (S)-oxprenolol(1+) (CHEBI:747615) is conjugate acid of (S)-oxprenolol (CHEBI:747561) |
| (R)-oxprenolol (CHEBI:747560) is enantiomer of (S)-oxprenolol (CHEBI:747561) |
| IUPAC Name |
|---|
| (2S)-1-(propan-2-ylamino)-3-[2-(prop-2-en-1-yloxy)phenoxy]propan-2-ol |
| Synonyms | Source |
|---|---|
| (−)-1-[o-(allyloxy)phenoxy]-3-isopropylamino-2-propanol | CAS |
| (2S)-1-[(1-methylethyl)amino]-3-[2-(2-propenyloxy)phenoxy]-2-propanol | CAS |
| (S)-1-(2-(allyloxy)phenoxy)-3-(isopropylamino)propan-2-ol | ChEBI |
| (S)-(−)-oxprenolol | CAS |
| S(−)-oxprenolol | ChEBI |
| S-oxprenolol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:22972-96-9 | CAS |
| Citations |
|---|