EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:747592 - (Z)-nitrofurazone
| Formula | C6H6N4O4 |
| Net Charge | 0 |
| Average Mass | 198.138 |
| Monoisotopic Mass | 198.03890 |
| SMILES | NC(=O)N/N=C\c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C6H6N4O4/c7-6(11)9-8-3-4-1-2-5(14-4)10(12)13/h1-3H,(H3,7,9,11)/b8-3- |
| InChIKey | IAIWVQXQOWNYOU-BAQGIRSFSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-nitrofurazone (CHEBI:747592) is a nitrofurazone (CHEBI:44368) |
| IUPAC Name |
|---|
| (2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinecarboxamide |
| Synonyms | Source |
|---|---|
| (2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazine-1-carboxamide | IUPAC |
| cis-nitrofurazone | ChEBI |
| [(Z)-(5-nitrofuran-2-yl)methylideneamino]urea | ChEBI |
| Z-nitrofurazone | ChEBI |
| Citations |
|---|