EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6N4O4 |
| Net Charge | 0 |
| Average Mass | 198.138 |
| Monoisotopic Mass | 198.03890 |
| SMILES | [H]C(=NNC(N)=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C6H6N4O4/c7-6(11)9-8-3-4-1-2-5(14-4)10(12)13/h1-3H,(H3,7,9,11) |
| InChIKey | IAIWVQXQOWNYOU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitrofurazone (CHEBI:44368) has role antibacterial drug (CHEBI:36047) |
| nitrofurazone (CHEBI:44368) is a nitrofuran antibiotic (CHEBI:87230) |
| nitrofurazone (CHEBI:44368) is a semicarbazone (CHEBI:87210) |
| IUPAC Name |
|---|
| 2-[(5-nitro-2-furyl)methylene]hydrazinecarboxamide |
| INNs | Source |
|---|---|
| nitrofural | WHO MedNet |
| nitrofural | WHO MedNet |
| nitrofural | WHO MedNet |
| nitrofuralum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-(5-nitro-2-furfurylidene)semicarbazide | ChemIDplus |
| 5-Nitro-2-furaldehyde semicarbazone | KEGG COMPOUND |
| (5-nitro-2-furfurylidenamino)urea | ChemIDplus |
| 5-nitrofuraldehyde semicarbazide | NIST Chemistry WebBook |
| 5-nitrofuran-2-carbaldehyde semicarbazone | PDBeChem |
| 5-nitrofurfural semicarbazone | NIST Chemistry WebBook |
| Brand Names | Source |
|---|---|
| Alfucin | ChemIDplus |
| Amifur | ChemIDplus |
| Chemofuran | ChemIDplus |
| Furacillin | ChemIDplus |
| Furacin | ChemIDplus |
| Furacinetten | ChemIDplus |
| Citations |
|---|