EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27O4 |
| Net Charge | -1 |
| Average Mass | 331.432 |
| Monoisotopic Mass | 331.19148 |
| SMILES | CC[C@H](O)/C=C/C=C\C/C=C\C=C\C=C\[C@H]1O[C@H]1CCCC(=O)[O-] |
| InChI | InChI=1S/C20H28O4/c1-2-17(21)13-10-8-6-4-3-5-7-9-11-14-18-19(24-18)15-12-16-20(22)23/h3,5-11,13-14,17-19,21H,2,4,12,15-16H2,1H3,(H,22,23)/p-1/b5-3-,8-6-,9-7+,13-10+,14-11+/t17-,18+,19-/m0/s1 |
| InChIKey | ZPAJZAMPZXISSE-RXTGXWMYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5(S)6-epoxy-18(S)-HEPE(1−) (CHEBI:747568) is a epoxy fatty acid anion (CHEBI:190711) |
| 5(S)6-epoxy-18(S)-HEPE(1−) (CHEBI:747568) is a hydroxy polyunsaturated fatty acid anion (CHEBI:131871) |
| 5(S)6-epoxy-18(S)-HEPE(1−) (CHEBI:747568) is a long-chain fatty acid anion (CHEBI:57560) |
| 5(S)6-epoxy-18(S)-HEPE(1−) (CHEBI:747568) is conjugate base of 5(S)6-epoxy-18(S)-HEPE (CHEBI:138490) |
| Incoming Relation(s) |
| 5(S)6-epoxy-18(S)-HEPE (CHEBI:138490) is conjugate acid of 5(S)6-epoxy-18(S)-HEPE(1−) (CHEBI:747568) |
| IUPAC Name |
|---|
| 4-{(2S,3R)-3-[(1E,3E,5Z,8Z,10E,12S)-12-hydroxytetradeca-1,3,5,8,10-pentaen-1-yl]oxiran-2-yl}butanoate |
| Synonyms | Source |
|---|---|
| 5S,6-Ep-18S-HEPE anion | ChEBI |
| 5(S)6-epoxy-18(S)-HEPE anion | ChEBI |
| 5S,6-epoxy,18S-hydroxy-7E,9E,11Z,14Z,16E-eicosapentaenoate | ChEBI |