EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O4 |
| Net Charge | 0 |
| Average Mass | 332.440 |
| Monoisotopic Mass | 332.19876 |
| SMILES | CC[C@H](O)/C=C/C=C\C/C=C\C=C\C=C\[C@H]1O[C@H]1CCCC(=O)O |
| InChI | InChI=1S/C20H28O4/c1-2-17(21)13-10-8-6-4-3-5-7-9-11-14-18-19(24-18)15-12-16-20(22)23/h3,5-11,13-14,17-19,21H,2,4,12,15-16H2,1H3,(H,22,23)/b5-3-,8-6-,9-7+,13-10+,14-11+/t17-,18+,19-/m0/s1 |
| InChIKey | ZPAJZAMPZXISSE-RXTGXWMYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5(S)6-epoxy-18(S)-HEPE (CHEBI:138490) has role metabolite (CHEBI:25212) |
| 5(S)6-epoxy-18(S)-HEPE (CHEBI:138490) is a epoxy fatty acid (CHEBI:61498) |
| 5(S)6-epoxy-18(S)-HEPE (CHEBI:138490) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| 5(S)6-epoxy-18(S)-HEPE (CHEBI:138490) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 4-{(2S,3R)-3-[(1E,3E,5Z,8Z,10E,12S)-12-hydroxytetradeca-1,3,5,8,10-pentaen-1-yl]oxiran-2-yl}butanoic acid |
| Synonyms | Source |
|---|---|
| 5S,6-Ep-18S-HEPE | LIPID MAPS |
| 5S,6-epoxy,18S-hydroxy-7E,9E,11Z,14Z,16E-eicosapentaenoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA03070040 | LIPID MAPS |
| Citations |
|---|