EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29O4 |
| Net Charge | -1 |
| Average Mass | 333.448 |
| Monoisotopic Mass | 333.20713 |
| SMILES | CC[C@H](O)C(O)/C=C/C=C/C=C\C/C=C\C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H30O4/c1-2-18(21)19(22)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-20(23)24/h3,5-6,8-12,14,16,18-19,21-22H,2,4,7,13,15,17H2,1H3,(H,23,24)/p-1/b5-3-,8-6-,11-9-,12-10+,16-14+/t18-,19?/m0/s1 |
| InChIKey | WYCMUVNNXSREQB-AZOGICFMSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| resolvin E3(1−) (CHEBI:747565) is a hydroxy polyunsaturated fatty acid anion (CHEBI:131871) |
| resolvin E3(1−) (CHEBI:747565) is conjugate base of resolvin E3 (CHEBI:138477) |
| Incoming Relation(s) |
| resolvin E3 (CHEBI:138477) is conjugate acid of resolvin E3(1−) (CHEBI:747565) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z,13E,15E,18S)-17,18-dihydroxyicosa-5,8,11,13,15-pentaenoate |
| Synonym | Source |
|---|---|
| resolvin E3 anion | ChEBI |