EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O4 |
| Net Charge | 0 |
| Average Mass | 334.456 |
| Monoisotopic Mass | 334.21441 |
| SMILES | CC[C@H](O)C(O)/C=C/C=C/C=C\C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H30O4/c1-2-18(21)19(22)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-20(23)24/h3,5-6,8-12,14,16,18-19,21-22H,2,4,7,13,15,17H2,1H3,(H,23,24)/b5-3-,8-6-,11-9-,12-10+,16-14+/t18-,19?/m0/s1 |
| InChIKey | WYCMUVNNXSREQB-AZOGICFMSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| resolvin E3 (CHEBI:138477) has role anti-inflammatory agent (CHEBI:67079) |
| resolvin E3 (CHEBI:138477) is a diol (CHEBI:23824) |
| resolvin E3 (CHEBI:138477) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| resolvin E3 (CHEBI:138477) is a resolvin (CHEBI:132120) |
| resolvin E3 (CHEBI:138477) is a secondary allylic alcohol (CHEBI:134396) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z,13E,15E,18S)-17,18-dihydroxyicosa-5,8,11,13,15-pentaenoic acid |
| Synonym | Source |
|---|---|
| RvE3 | ChEBI |
| Citations |
|---|