EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:747352 - oprozomib
| Formula | C25H32N4O7S |
| Net Charge | 0 |
| Average Mass | 532.619 |
| Monoisotopic Mass | 532.19917 |
| SMILES | COC[C@H](NC(=O)c1cnc(C)s1)C(=O)N[C@@H](COC)C(=O)N[C@@H](Cc1ccccc1)C(=O)[C@@]1(C)CO1 |
| InChI | InChI=1S/C25H32N4O7S/c1-15-26-11-20(37-15)24(33)29-19(13-35-4)23(32)28-18(12-34-3)22(31)27-17(21(30)25(2)14-36-25)10-16-8-6-5-7-9-16/h5-9,11,17-19H,10,12-14H2,1-4H3,(H,27,31)(H,28,32)(H,29,33)/t17-,18-,19-,25+/m0/s1 |
| InChIKey | SWZXEVABPLUDIO-WSZYKNRRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | proteasome inhibitor A drug that blocks the action of proteasomes, cellular complexes that break down proteins. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oprozomib (CHEBI:747352) has functional parent O-methylserine (CHEBI:74798) |
| oprozomib (CHEBI:747352) has functional parent L-phenylalanine (CHEBI:17295) |
| oprozomib (CHEBI:747352) has role angiogenesis inhibitor (CHEBI:48422) |
| oprozomib (CHEBI:747352) has role antineoplastic agent (CHEBI:35610) |
| oprozomib (CHEBI:747352) has role apoptosis inducer (CHEBI:68495) |
| oprozomib (CHEBI:747352) has role proteasome inhibitor (CHEBI:52726) |
| oprozomib (CHEBI:747352) is a 1,3-thiazolecarboxamide (CHEBI:48890) |
| oprozomib (CHEBI:747352) is a diether (CHEBI:46786) |
| oprozomib (CHEBI:747352) is a epoxide (CHEBI:32955) |
| oprozomib (CHEBI:747352) is a ether (CHEBI:25698) |
| oprozomib (CHEBI:747352) is a secondary carboxamide (CHEBI:140325) |
| oprozomib (CHEBI:747352) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| 4,5-anhydro-1,2-dideoxy-4-methyl-2-({O-methyl-N-[(2-methyl-1,3-thiazol-5-yl)carbonyl]-L-seryl-O-methyl-L-seryl}amino)-1-phenyl-D-erythro-pent-3-ulose |
| INNs | Source |
|---|---|
| oprozomib | WHO MedNet |
| oprozomib | WHO MedNet |
| oprozomib | WHO MedNet |
| oprozomibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| O-methyl-N-[(2-methyl-5-thiazolyl)carbonyl]-L-seryl-O-methyl-N-[(1S)-2-[(2R)-2-methyl-2-oxiranyl]-2-oxo-1-(phenylmethyl)ethyl]-L-serinamide | CAS |
| ONO-7058 | ChEBI |
| ONX-012 | ChEBI |
| ONX 0912 | DrugBank |
| ONX-0912 | DrugBank |
| ONX0912 | ChEBI |
| Citations |
|---|