EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO3 |
| Net Charge | 0 |
| Average Mass | 119.120 |
| Monoisotopic Mass | 119.05824 |
| SMILES | COC[C@H](N)C(=O)O |
| InChI | InChI=1S/C4H9NO3/c1-8-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1 |
| InChIKey | KNTFCRCCPLEUQZ-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-methylserine (CHEBI:74798) has role metabolite (CHEBI:25212) |
| O-methylserine (CHEBI:74798) is a L-serine derivative (CHEBI:84135) |
| O-methylserine (CHEBI:74798) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| O-methyl-L-serine |
| Synonym | Source |
|---|---|
| O-methyl-L-Ser | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721672 | Reaxys |
| Citations |
|---|