EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20O6 |
| Net Charge | 0 |
| Average Mass | 320.341 |
| Monoisotopic Mass | 320.12599 |
| SMILES | CC(=O)O[C@@]1(C)C(=O)C=C2C=C(CCC[C@H](C)O)OC=C2C1=O |
| InChI | InChI=1S/C17H20O6/c1-10(18)5-4-6-13-7-12-8-15(20)17(3,23-11(2)19)16(21)14(12)9-22-13/h7-10,18H,4-6H2,1-3H3/t10-,17-/m0/s1 |
| InChIKey | QUBJVRATDUPEAJ-BTDLBPIBSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (7S)‐3‐[(4S)‐4‐hydroxypentyl]‐7‐methyl‐6,8‐dioxo‐7,8‐dihydro‐6H‐isochromen‐7‐yl acetate (CHEBI:747266) is a acetate ester (CHEBI:47622) |
| (7S)‐3‐[(4S)‐4‐hydroxypentyl]‐7‐methyl‐6,8‐dioxo‐7,8‐dihydro‐6H‐isochromen‐7‐yl acetate (CHEBI:747266) is a azaphilone (CHEBI:50941) |
| UniProt Name | Source |
|---|---|
| (7S)‐3‐[(4S)‐4‐hydroxypentyl]‐7‐methyl‐6,8‐dioxo‐7,8‐dihydro‐6H‐isochromen‐7‐yl acetate | UniProt |
| Citations |
|---|