EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H33O5 |
| Net Charge | -1 |
| Average Mass | 329.457 |
| Monoisotopic Mass | 329.23335 |
| SMILES | CCCCCC(O)/C=C/C(O)C(O)CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H34O5/c1-2-3-7-10-15(19)13-14-17(21)16(20)11-8-5-4-6-9-12-18(22)23/h13-17,19-21H,2-12H2,1H3,(H,22,23)/p-1/b14-13+ |
| InChIKey | NTVFQBIHLSPEGQ-BUHFOSPRSA-M |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,1,13-TriHOME(1-) (CHEBI:747175) is a octadecanoid anion (CHEBI:131860) |
| 9,1,13-TriHOME(1-) (CHEBI:747175) is a TriHOME (CHEBI:73765) |
| 9,1,13-TriHOME(1-) (CHEBI:747175) is conjugate base of 9,10,13-TriHOME (CHEBI:34499) |
| Synonym | Source |
|---|---|
| FA 18:1(11E;9OH,10OH,13OH) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (9,10,13)-trihydroxy-(11E)-octadecenoate | UniProt |