EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O5 |
| Net Charge | 0 |
| Average Mass | 330.465 |
| Monoisotopic Mass | 330.24062 |
| SMILES | CCCCCC(O)/C=C/C(O)C(O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O5/c1-2-3-7-10-15(19)13-14-17(21)16(20)11-8-5-4-6-9-12-18(22)23/h13-17,19-21H,2-12H2,1H3,(H,22,23)/b14-13+ |
| InChIKey | NTVFQBIHLSPEGQ-BUHFOSPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (21359215) | |
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS243) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,10,13-TriHOME (CHEBI:34499) has role human blood serum metabolite (CHEBI:85234) |
| 9,10,13-TriHOME (CHEBI:34499) is a long-chain fatty acid (CHEBI:15904) |
| 9,10,13-TriHOME (CHEBI:34499) is a monounsaturated fatty acid (CHEBI:25413) |
| 9,10,13-TriHOME (CHEBI:34499) is a straight-chain fatty acid (CHEBI:59202) |
| 9,10,13-TriHOME (CHEBI:34499) is a TriHOME (CHEBI:73765) |
| Incoming Relation(s) |
| 9,1,13-TriHOME(1-) (CHEBI:747175) is conjugate base of 9,10,13-TriHOME (CHEBI:34499) |
| IUPAC Name |
|---|
| (11E)-9,10,13-trihydroxyoctadec-11-enoic acid |
| Synonyms | Source |
|---|---|
| (11E)-9,10,13-trihydroxyoctadecenoic acid | ChEBI |
| 9,10,13-TriHOME | KEGG COMPOUND |
| 9,10,13-trihydroxy-11-octadecenoic acid | LIPID MAPS |
| 9,10,13-Trihydroxyoctadec-11-enoic acid | KEGG COMPOUND |
| (E)-9,10,13-Trihydroxy-11-octadecenoic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C14835 | KEGG COMPOUND |
| LMFA02000168 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2282736 | Reaxys |
| CAS:29907-57-1 | KEGG COMPOUND |
| CAS:29907-57-1 | ChemIDplus |
| Citations |
|---|