EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H27F2N5O3 |
| Net Charge | 0 |
| Average Mass | 507.541 |
| Monoisotopic Mass | 507.20820 |
| SMILES | C=CC(=O)N(C)CCOc1c(N)ncnc1-c1cc(F)cc(NC(=O)c2ccc(C3CC3)cc2F)c1C |
| InChI | InChI=1S/C27H27F2N5O3/c1-4-23(35)34(3)9-10-37-25-24(31-14-32-26(25)30)20-12-18(28)13-22(15(20)2)33-27(36)19-8-7-17(11-21(19)29)16-5-6-16/h4,7-8,11-14,16H,1,5-6,9-10H2,2-3H3,(H,33,36)(H2,30,31,32) |
| InChIKey | CUABMPOJOBCXJI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Remibrutinib (CHEBI:746867) has role tyrosine kinase inhibitor (CHEBI:38637) |
| Remibrutinib (CHEBI:746867) is a monofluorobenzenes (CHEBI:83575) |
| Remibrutinib (CHEBI:746867) is a secondary carboxamide (CHEBI:140325) |
| Brand Name | Source |
|---|---|
| Rhapsido | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D12285 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:1787294-07-8 | KEGG DRUG |