EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H35F3O6 |
| Net Charge | 0 |
| Average Mass | 500.554 |
| Monoisotopic Mass | 500.23857 |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)COc2cccc(C(F)(F)F)c2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C26H35F3O6/c1-17(2)35-25(33)11-6-4-3-5-10-21-22(24(32)15-23(21)31)13-12-19(30)16-34-20-9-7-8-18(14-20)26(27,28)29/h3,5,7-9,12-14,17,19,21-24,30-32H,4,6,10-11,15-16H2,1-2H3/b5-3-,13-12+/t19-,21-,22-,23+,24-/m1/s1 |
| InChIKey | MKPLKVHSHYCHOC-AHTXBMBWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | prostaglandin receptor agonist An agonist that binds to and activates prostaglandin receptors. |
| Applications: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| travoprost (CHEBI:746859) has functional parent fluprostenol (CHEBI:60782) |
| travoprost (CHEBI:746859) has role antiglaucoma drug (CHEBI:39456) |
| travoprost (CHEBI:746859) has role antihypertensive agent (CHEBI:35674) |
| travoprost (CHEBI:746859) has role ophthalmology drug (CHEBI:66981) |
| travoprost (CHEBI:746859) has role prodrug (CHEBI:50266) |
| travoprost (CHEBI:746859) has role prostaglandin receptor agonist (CHEBI:66900) |
| travoprost (CHEBI:746859) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| travoprost (CHEBI:746859) is a isopropyl ester (CHEBI:35725) |
| travoprost (CHEBI:746859) is a prostaglandins Fα (CHEBI:36066) |
| IUPAC Name |
|---|
| propan-2-yl (5Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-{(1E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-en-1-yl}cyclopentyl]hept-5-enoate |
| INNs | Source |
|---|---|
| travoprost | ChemIDplus |
| travoprost | WHO MedNet |
| travoprost | WHO MedNet |
| travoprostum | WHO MedNet |
| Synonyms | Source |
|---|---|
| isopropyl (Z)-7-((1R,2R,3R,5S)-3,5-dihydroxy-2-{(1E,3R)-3-hydroxy-4-[(α,α,α-trifluoro-m-tolyl)oxy]-1-butenyl}cyclopentyl)-5-heptenoate | ChEBI |
| Travoprost | ChEMBL |
| Brand Names | Source |
|---|---|
| Travatan | KEGG DRUG |
| Travatan Z | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2716 | DrugCentral |
| D01964 | KEGG DRUG |
| DB00287 | DrugBank |
| HMDB0014432 | HMDB |
| Travoprost | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8739060 | Reaxys |
| CAS:157283-68-6 | ChemIDplus |
| CAS:157283-68-6 | KEGG DRUG |
| Citations |
|---|