EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H29F3O6 |
| Net Charge | 0 |
| Average Mass | 458.473 |
| Monoisotopic Mass | 458.19162 |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)COc2cccc(C(F)(F)F)c2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C23H29F3O6/c24-23(25,26)15-6-5-7-17(12-15)32-14-16(27)10-11-19-18(20(28)13-21(19)29)8-3-1-2-4-9-22(30)31/h1,3,5-7,10-12,16,18-21,27-29H,2,4,8-9,13-14H2,(H,30,31)/b3-1-,11-10+/t16-,18-,19-,20+,21-/m1/s1 |
| InChIKey | WWSWYXNVCBLWNZ-QIZQQNKQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | prostaglandin receptor agonist An agonist that binds to and activates prostaglandin receptors. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. female contraceptive drug A chemical substance or agent with contraceptive activity in females. abortifacient A chemical substance that interrupts pregnancy after implantation. antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluprostenol (CHEBI:60782) has role abortifacient (CHEBI:50691) |
| fluprostenol (CHEBI:60782) has role antiglaucoma drug (CHEBI:39456) |
| fluprostenol (CHEBI:60782) has role antihypertensive agent (CHEBI:35674) |
| fluprostenol (CHEBI:60782) has role female contraceptive drug (CHEBI:49324) |
| fluprostenol (CHEBI:60782) has role prostaglandin receptor agonist (CHEBI:66900) |
| fluprostenol (CHEBI:60782) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| fluprostenol (CHEBI:60782) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| fluprostenol (CHEBI:60782) is a prostaglandins Fα (CHEBI:36066) |
| Incoming Relation(s) |
| travoprost (CHEBI:746859) has functional parent fluprostenol (CHEBI:60782) |
| IUPAC Name |
|---|
| rac-(5Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-{(1E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-en-1-yl}cyclopentyl]hept-5-enoic acid |
| INNs | Source |
|---|---|
| fluprostenol | ChemIDplus |
| fluprostenolum | ChemIDplus |
| fluprostenol | WHO MedNet |
| fluprosténol | WHO MedNet |
| Synonyms | Source |
|---|---|
| travoprost acid | ChEBI |
| travoprost free acid | ChEBI |
| ICI 81,008 | ChemIDplus |
| EINECS 255-029-3 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8368795 | Reaxys |
| CAS:40666-16-8 | ChemIDplus |
| Citations |
|---|