EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H3IO2 |
| Net Charge | 0 |
| Average Mass | 185.948 |
| Monoisotopic Mass | 185.91778 |
| SMILES | O=C(O)CI |
| InChI | InChI=1S/C2H3IO2/c3-1-2(4)5/h1H2,(H,4,5) |
| InChIKey | JDNTWHVOXJZDSN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iodoacetic acid (CHEBI:74571) has role alkylating agent (CHEBI:22333) |
| iodoacetic acid (CHEBI:74571) is a haloacetic acid (CHEBI:16277) |
| iodoacetic acid (CHEBI:74571) is a organoiodine compound (CHEBI:37142) |
| Incoming Relation(s) |
| iodoacetacte (CHEBI:747879) is conjugate base of iodoacetic acid (CHEBI:74571) |
| IUPAC Name |
|---|
| iodoacetic acid |
| Synonyms | Source |
|---|---|
| 2-iodoacetic acid | ChEBI |
| CH2ICOOH | ChEBI |
| CH2ICO2H | ChEBI |
| ICH2COOH | ChEBI |
| ICH2CO2H | ChEBI |
| iodoethanoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| Iodoacetic_acid | Wikipedia |
| LMFA01090135 | LIPID MAPS |
| LSM-5944 | LINCS |
| Citations |
|---|