EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15N4O7P |
| Net Charge | 0 |
| Average Mass | 346.236 |
| Monoisotopic Mass | 346.06784 |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H15N4O7P/c12-9-5-1-2-15(10(5)14-4-13-9)11-8(17)7(16)6(22-11)3-21-23(18,19)20/h1-2,4,6-8,11,16-17H,3H2,(H2,12,13,14)(H2,18,19,20)/t6-,7-,8-,11-/m1/s1 |
| InChIKey | OBKZXEICLJXEAO-KCGFPETGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TuMP (CHEBI:74555) has functional parent tubercidin (CHEBI:48267) |
| TuMP (CHEBI:74555) has role metabolite (CHEBI:25212) |
| TuMP (CHEBI:74555) is a ribonucleoside 5'-monophosphate (CHEBI:37010) |
| IUPAC Name |
|---|
| 7-(5-O-phosphono-β-D-ribofuranosyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| Synonyms | Source |
|---|---|
| tubercidin 5'-monophosphate | ChEBI |
| tubercidin monophosphate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1039016 | Reaxys |
| CAS:16719-46-3 | ChemIDplus |
| Citations |
|---|