EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:48267 - tubercidin
| Formula | C11H14N4O4 |
| Net Charge | 0 |
| Average Mass | 266.257 |
| Monoisotopic Mass | 266.10150 |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H14N4O4/c12-9-5-1-2-15(10(5)14-4-13-9)11-8(18)7(17)6(3-16)19-11/h1-2,4,6-8,11,16-18H,3H2,(H2,12,13,14)/t6-,7-,8-,11-/m1/s1 |
| InChIKey | HDZZVAMISRMYHH-KCGFPETGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinopolyspora erythraea YIM 90600 (ncbitaxon:414996) | mycelium (BTO:0001436) | PubMed (21870828) | EtOAc extract of fermentation broth and Acetone extract of mycelia were together used |
| Caulospongia biflabellata (ncbitaxon:297728) | - | PubMed (21870828) | |
| Streptomyces tubercidicus (ncbitaxon:47759) | - | PubMed (21870828) | |
| Tolypothrix byssoidea (WORMS:213754) | - | PubMed (21870828) |
| Roles Classification |
|---|
| Biological Roles: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tubercidin (CHEBI:48267) has role antimetabolite (CHEBI:35221) |
| tubercidin (CHEBI:48267) has role antineoplastic agent (CHEBI:35610) |
| tubercidin (CHEBI:48267) has role bacterial metabolite (CHEBI:76969) |
| tubercidin (CHEBI:48267) is a N-glycosylpyrrolopyrimidine (CHEBI:48036) |
| tubercidin (CHEBI:48267) is a antibiotic antifungal agent (CHEBI:86478) |
| tubercidin (CHEBI:48267) is a ribonucleoside (CHEBI:18254) |
| Incoming Relation(s) |
| (Rp)-7-bromo-7-deaza-cAMPS (CHEBI:84625) has functional parent tubercidin (CHEBI:48267) |
| (Rp)-7-deaza-cAMPS (CHEBI:84624) has functional parent tubercidin (CHEBI:48267) |
| (Rp)-8-bromo-7-deaza-cAMPS (CHEBI:84623) has functional parent tubercidin (CHEBI:48267) |
| (Sp)-7-bromo-7-deaza-cAMPS (CHEBI:84621) has functional parent tubercidin (CHEBI:48267) |
| (Sp)-8-bromo-7-deaza-cAMPS (CHEBI:84620) has functional parent tubercidin (CHEBI:48267) |
| 5-iodotubercidin (CHEBI:40167) has functional parent tubercidin (CHEBI:48267) |
| 7-deaza-8-chloro-cAMP (CHEBI:84611) has functional parent tubercidin (CHEBI:48267) |
| 7-deaza-cAMP (CHEBI:84607) has functional parent tubercidin (CHEBI:48267) |
| 7-deaza-cGMP (CHEBI:84637) has functional parent tubercidin (CHEBI:48267) |
| sangivamycic acid (CHEBI:143700) has functional parent tubercidin (CHEBI:48267) |
| TuMP (CHEBI:74555) has functional parent tubercidin (CHEBI:48267) |
| IUPAC Name |
|---|
| 7-(β-D-ribofuranosyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| Synonyms | Source |
|---|---|
| 7-Deazaadenosine | ChemIDplus |
| Sparsomycin A | ChemIDplus |