EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:48267 - tubercidin
| Formula | C11H14N4O4 |
| Net Charge | 0 |
| Average Mass | 266.257 |
| Monoisotopic Mass | 266.10150 |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H14N4O4/c12-9-5-1-2-15(10(5)14-4-13-9)11-8(18)7(17)6(3-16)19-11/h1-2,4,6-8,11,16-18H,3H2,(H2,12,13,14)/t6-,7-,8-,11-/m1/s1 |
| InChIKey | HDZZVAMISRMYHH-KCGFPETGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinopolyspora erythraea YIM 90600 (ncbitaxon:414996) | mycelium (BTO:0001436) | PubMed (21870828) | EtOAc extract of fermentation broth and Acetone extract of mycelia were together used |
| Caulospongia biflabellata (ncbitaxon:297728) | - | PubMed (21870828) | |
| Streptomyces tubercidicus (ncbitaxon:47759) | - | PubMed (21870828) | |
| Tolypothrix byssoidea (WORMS:213754) | - | PubMed (21870828) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tubercidin (CHEBI:48267) has role antimetabolite (CHEBI:35221) |
| tubercidin (CHEBI:48267) has role antineoplastic agent (CHEBI:35610) |
| tubercidin (CHEBI:48267) has role bacterial metabolite (CHEBI:76969) |
| tubercidin (CHEBI:48267) is a N-glycosylpyrrolopyrimidine (CHEBI:48036) |
| tubercidin (CHEBI:48267) is a antibiotic antifungal agent (CHEBI:86478) |
| tubercidin (CHEBI:48267) is a ribonucleoside (CHEBI:18254) |
| Incoming Relation(s) |
| (Rp)-7-bromo-7-deaza-cAMPS (CHEBI:84625) has functional parent tubercidin (CHEBI:48267) |
| (Rp)-7-deaza-cAMPS (CHEBI:84624) has functional parent tubercidin (CHEBI:48267) |
| (Rp)-8-bromo-7-deaza-cAMPS (CHEBI:84623) has functional parent tubercidin (CHEBI:48267) |
| (Sp)-7-bromo-7-deaza-cAMPS (CHEBI:84621) has functional parent tubercidin (CHEBI:48267) |
| (Sp)-8-bromo-7-deaza-cAMPS (CHEBI:84620) has functional parent tubercidin (CHEBI:48267) |
| 5-iodotubercidin (CHEBI:40167) has functional parent tubercidin (CHEBI:48267) |
| 7-deaza-8-chloro-cAMP (CHEBI:84611) has functional parent tubercidin (CHEBI:48267) |
| 7-deaza-cAMP (CHEBI:84607) has functional parent tubercidin (CHEBI:48267) |
| 7-deaza-cGMP (CHEBI:84637) has functional parent tubercidin (CHEBI:48267) |
| sangivamycic acid (CHEBI:143700) has functional parent tubercidin (CHEBI:48267) |
| TuMP (CHEBI:74555) has functional parent tubercidin (CHEBI:48267) |
| IUPAC Name |
|---|
| 7-(β-D-ribofuranosyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| Synonyms | Source |
|---|---|
| 7-Deazaadenosine | ChemIDplus |
| Sparsomycin A | ChemIDplus |