EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20N4O3 |
| Net Charge | 0 |
| Average Mass | 268.317 |
| Monoisotopic Mass | 268.15354 |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C12H20N4O3/c1-7(2)3-9(13)11(17)16-10(12(18)19)4-8-5-14-6-15-8/h5-7,9-10H,3-4,13H2,1-2H3,(H,14,15)(H,16,17)(H,18,19)/t9-,10-/m0/s1 |
| InChIKey | XWOBNBRUDDUEEY-UWVGGRQHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-His (CHEBI:74539) has role metabolite (CHEBI:25212) |
| Leu-His (CHEBI:74539) is a dipeptide (CHEBI:46761) |
| Leu-His (CHEBI:74539) is tautomer of Leu-His zwitterion (CHEBI:235401) |
| Incoming Relation(s) |
| Leu-His zwitterion (CHEBI:235401) is tautomer of Leu-His (CHEBI:74539) |
| IUPAC Name |
|---|
| L-leucyl-L-histidine |
| Synonyms | Source |
|---|---|
| LH | ChEBI |
| leucylhistidine | ChEBI |
| L-Leu-L-His | ChEBI |
| Leucyl-Histidine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028931 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:89792 | Reaxys |