EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20N4O3 |
| Net Charge | 0 |
| Average Mass | 268.317 |
| Monoisotopic Mass | 268.15354 |
| SMILES | CC(C)C[C@H]([NH3+])C(=O)N[C@@H](Cc1cncn1)C(=O)[O-] |
| InChI | InChI=1S/C12H20N4O3/c1-7(2)3-9(13)11(17)16-10(12(18)19)4-8-5-14-6-15-8/h5-7,9-10H,3-4,13H2,1-2H3,(H,14,15)(H,16,17)(H,18,19)/t9-,10-/m0/s1 |
| InChIKey | XWOBNBRUDDUEEY-UWVGGRQHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-His zwitterion (CHEBI:235401) is a dipeptide zwitterion (CHEBI:90799) |
| Leu-His zwitterion (CHEBI:235401) is tautomer of Leu-His (CHEBI:74539) |
| Incoming Relation(s) |
| Leu-His (CHEBI:74539) is tautomer of Leu-His zwitterion (CHEBI:235401) |