EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:74537 - monothioglycerol
| Formula | C3H8O2S |
| Net Charge | 0 |
| Average Mass | 108.162 |
| Monoisotopic Mass | 108.02450 |
| SMILES | OCC(O)CS |
| InChI | InChI=1S/C3H8O2S/c4-1-3(5)2-6/h3-6H,1-2H2 |
| InChIKey | PJUIMOJAAPLTRJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | reducing agent The element or compound in a reduction-oxidation (redox) reaction that donates an electron to another species. |
| Application: | vulnerary A drug used in treating and healing of wounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monothioglycerol (CHEBI:74537) has role reducing agent (CHEBI:63247) |
| monothioglycerol (CHEBI:74537) has role vulnerary (CHEBI:73336) |
| monothioglycerol (CHEBI:74537) is a propane-1,2-diols (CHEBI:26284) |
| monothioglycerol (CHEBI:74537) is a thiol (CHEBI:29256) |
| Incoming Relation(s) |
| monothioglycerolipid (CHEBI:83703) has functional parent monothioglycerol (CHEBI:74537) |
| monothioglycerophosphocholine (CHEBI:140064) has functional parent monothioglycerol (CHEBI:74537) |
| (R)-monothioglycerol (CHEBI:45619) is a monothioglycerol (CHEBI:74537) |
| IUPAC Name |
|---|
| 3-sulfanylpropane-1,2-diol |
| Synonyms | Source |
|---|---|
| thioglycerine | ChemIDplus |
| α-thiolglycerol | ChemIDplus |
| 1-mercapto-2,3-propanediol | ChemIDplus |
| thioglycerol | ChemIDplus |
| 1-mercaptoglycerol | ChemIDplus |
| 1-monothioglycerol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD0-1951 | MetaCyc |
| D05075 | KEGG DRUG |
| 3-Mercaptopropane-1,2-diol | Wikipedia |
| Citations |
|---|