EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H8O2S |
| Net Charge | 0 |
| Average Mass | 108.162 |
| Monoisotopic Mass | 108.02450 |
| SMILES | OC[C@@H](O)CS |
| InChI | InChI=1S/C3H8O2S/c4-1-3(5)2-6/h3-6H,1-2H2/t3-/m1/s1 |
| InChIKey | PJUIMOJAAPLTRJ-GSVOUGTGSA-N |
| Roles Classification |
|---|
| Chemical Role: | reducing agent The element or compound in a reduction-oxidation (redox) reaction that donates an electron to another species. |
| Application: | vulnerary A drug used in treating and healing of wounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-monothioglycerol (CHEBI:45619) is a monothioglycerol (CHEBI:74537) |
| IUPAC Name |
|---|
| (2R)-3-sulfanylpropane-1,2-diol |
| Synonyms | Source |
|---|---|
| (R)-(−)-2,3-dihydroxypropane-1-thiol | ChEBI |
| (−)-(R)-3-mercapto-1,2-propanediol | ChEBI |
| R-(−)-3-mercapto-1,2-propanediol | ChEBI |
| (R)-3-mercaptopropane-1,2-diol | ChEBI |
| D-1-thioglycerol | ChEBI |