EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N2O4 |
| Net Charge | 0 |
| Average Mass | 228.248 |
| Monoisotopic Mass | 228.11101 |
| SMILES | O=C(O)[C@@H]1C[C@@H](O)CN1C(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C10H16N2O4/c13-6-4-8(10(15)16)12(5-6)9(14)7-2-1-3-11-7/h6-8,11,13H,1-5H2,(H,15,16)/t6-,7+,8+/m1/s1 |
| InChIKey | ONPXCLZMBSJLSP-CSMHCCOUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (12636053) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | diagnostic agent A substance administered to aid diagnosis of a disease. biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pro-Hyp (CHEBI:74767) has functional parent trans-4-hydroxy-L-proline (CHEBI:18095) |
| Pro-Hyp (CHEBI:74767) has functional parent L-proline (CHEBI:17203) |
| Pro-Hyp (CHEBI:74767) has role biomarker (CHEBI:59163) |
| Pro-Hyp (CHEBI:74767) has role diagnostic agent (CHEBI:33295) |
| Pro-Hyp (CHEBI:74767) has role human metabolite (CHEBI:77746) |
| Pro-Hyp (CHEBI:74767) is a dipeptide (CHEBI:46761) |
| Pro-Hyp (CHEBI:74767) is tautomer of Pro-Hyp zwitterion (CHEBI:133733) |
| Incoming Relation(s) |
| Pro-Hyp zwitterion (CHEBI:133733) is tautomer of Pro-Hyp (CHEBI:74767) |
| IUPAC Name |
|---|
| L-prolyl-(4R)-4-hydroxy-L-proline |
| Synonyms | Source |
|---|---|
| L-Prolyl-L-hydroxyproline | HMDB |
| Prolylhydroxyproline | HMDB |
| L-Pro-L-Hyp | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0006695 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21943 | Reaxys |
| CAS:18684-24-7 | HMDB |
| Citations |
|---|