EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7N3O |
| Net Charge | 0 |
| Average Mass | 137.142 |
| Monoisotopic Mass | 137.05891 |
| SMILES | NC(=O)c1ccc(N)nc1 |
| InChI | InChI=1S/C6H7N3O/c7-5-2-1-4(3-9-5)6(8)10/h1-3H,(H2,7,9)(H2,8,10) |
| InChIKey | ZLWYEPMDOUQDBW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. EC 1.1.1.44 (NADP(+)-dependent decarboxylating phosphogluconate dehydrogenase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of NADP+-dependent decarboxylating phosphogluconate dehydrogenase (EC 1.1.1.44). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-aminonicotinamide (CHEBI:74514) has functional parent 6-aminonicotinic acid (CHEBI:68583) |
| 6-aminonicotinamide (CHEBI:74514) has role antimetabolite (CHEBI:35221) |
| 6-aminonicotinamide (CHEBI:74514) has role EC 1.1.1.44 (NADP+-dependent decarboxylating phosphogluconate dehydrogenase) inhibitor (CHEBI:74520) |
| 6-aminonicotinamide (CHEBI:74514) has role teratogenic agent (CHEBI:50905) |
| 6-aminonicotinamide (CHEBI:74514) is a aminopyridine (CHEBI:38207) |
| 6-aminonicotinamide (CHEBI:74514) is a monocarboxylic acid amide (CHEBI:29347) |
| 6-aminonicotinamide (CHEBI:74514) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| 6-aminonicotinamide |
| Synonyms | Source |
|---|---|
| 2-amino-5-carbamoylpyridine | ChemIDplus |
| 6-amino-3-pyridinecarboxamide | NIST Chemistry WebBook |
| 6-aminonicotinic acid amide | ChEBI |
| 6-Aminonikotinsaeureamid | ChemIDplus |
| 6-AN | NIST Chemistry WebBook |
| 6-ANA | NIST Chemistry WebBook |
| Citations |
|---|