EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H25NO3 |
| Net Charge | 0 |
| Average Mass | 243.347 |
| Monoisotopic Mass | 243.18344 |
| SMILES | CCCCCCCCCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C13H25NO3/c1-2-3-4-5-6-7-8-9-10-12(15)14-11-13(16)17/h2-11H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | HEUQYIQQCNOXOG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-undecanoylglycine (CHEBI:74438) has functional parent glycine (CHEBI:15428) |
| N-undecanoylglycine (CHEBI:74438) has functional parent undecanoic acid (CHEBI:32368) |
| N-undecanoylglycine (CHEBI:74438) has role metabolite (CHEBI:25212) |
| N-undecanoylglycine (CHEBI:74438) is a N-acylglycine (CHEBI:16180) |
| N-undecanoylglycine (CHEBI:74438) is a fatty amide (CHEBI:29348) |
| IUPAC Names |
|---|
| (undecanoylamino)acetic acid |
| N-undecanoylglycine |
| Synonyms | Source |
|---|---|
| Acylglycine C:11 | HMDB |
| undecanamidoacetic acid | HMDB |
| 2-undecanamidoacetic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013286 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6720818 | Reaxys |