EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O2 |
| Net Charge | 0 |
| Average Mass | 228.291 |
| Monoisotopic Mass | 228.11503 |
| SMILES | COc1ccc2cc(CCC(C)=O)ccc2c1 |
| InChI | InChI=1S/C15H16O2/c1-11(16)3-4-12-5-6-14-10-15(17-2)8-7-13(14)9-12/h5-10H,3-4H2,1-2H3 |
| InChIKey | BLXXJMDCKKHMKV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nabumetone (CHEBI:7443) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| nabumetone (CHEBI:7443) has role non-narcotic analgesic (CHEBI:35481) |
| nabumetone (CHEBI:7443) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| nabumetone (CHEBI:7443) has role prodrug (CHEBI:50266) |
| nabumetone (CHEBI:7443) is a methoxynaphthalene (CHEBI:48851) |
| nabumetone (CHEBI:7443) is a methyl ketone (CHEBI:51867) |
| INNs | Source |
|---|---|
| nabumetona | ChemIDplus |
| nabumetone | KEGG DRUG |
| nabumetonum | DrugBank |
| Synonyms | Source |
|---|---|
| 4-(6-Methoxy-2-naphthalenyl)-2-butanone | ChemIDplus |
| 4-(6-Methoxy-2-naphthyl)-2-butanone | ChemIDplus |
| Brand Name | Source |
|---|---|
| Relafen | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 1863 | DrugCentral |
| D00425 | KEGG DRUG |
| DB00461 | DrugBank |
| HMDB0014604 | HMDB |
| LSM-3453 | LINCS |
| Nabumetone | Wikipedia |
| NBO | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2103472 | Reaxys |
| CAS:42924-53-8 | ChemIDplus |
| CAS:42924-53-8 | NIST Chemistry WebBook |
| CAS:42924-53-8 | KEGG DRUG |
| Citations |
|---|