EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O4 |
| Net Charge | 0 |
| Average Mass | 190.199 |
| Monoisotopic Mass | 190.09536 |
| SMILES | C[C@H]([NH3+])C(=O)N[C@H](C(=O)[O-])[C@@H](C)O |
| InChI | InChI=1S/C7H14N2O4/c1-3(8)6(11)9-5(4(2)10)7(12)13/h3-5,10H,8H2,1-2H3,(H,9,11)(H,12,13)/t3-,4+,5-/m0/s1 |
| InChIKey | BUQICHWNXBIBOG-LMVFSUKVSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Thr zwitterion (CHEBI:74390) is a dipeptide zwitterion (CHEBI:90799) |
| Ala-Thr zwitterion (CHEBI:74390) is tautomer of Ala-Thr (CHEBI:73762) |
| Incoming Relation(s) |
| Ala-Thr (CHEBI:73762) is tautomer of Ala-Thr zwitterion (CHEBI:74390) |
| IUPAC Name |
|---|
| (2S,3S)-2-{[(2S)-2-azaniumylpropanoyl]amino}-3-hydroxybutanoate |
| Synonyms | Source |
|---|---|
| alanylthreonine zwitterion | ChEBI |
| AT zwitterion | ChEBI |
| L-alanyl-L-threonine zwitterion | ChEBI |
| L-Ala-L-Thr zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| L-alanyl-L-threonine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-13397 | MetaCyc |