EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O4 |
| Net Charge | 0 |
| Average Mass | 190.199 |
| Monoisotopic Mass | 190.09536 |
| SMILES | C[C@H](N)C(=O)N[C@H](C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C7H14N2O4/c1-3(8)6(11)9-5(4(2)10)7(12)13/h3-5,10H,8H2,1-2H3,(H,9,11)(H,12,13)/t3-,4+,5-/m0/s1 |
| InChIKey | BUQICHWNXBIBOG-LMVFSUKVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Thr (CHEBI:73762) has role metabolite (CHEBI:25212) |
| Ala-Thr (CHEBI:73762) is a dipeptide (CHEBI:46761) |
| Ala-Thr (CHEBI:73762) is tautomer of Ala-Thr zwitterion (CHEBI:74390) |
| Incoming Relation(s) |
| Ala-Thr zwitterion (CHEBI:74390) is tautomer of Ala-Thr (CHEBI:73762) |
| IUPAC Name |
|---|
| L-alanyl-L-threonine |
| Synonyms | Source |
|---|---|
| AT | ChEBI |
| alanylthrenone | ChEBI |
| L-Ala-L-Thr | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028697 | HMDB |
| CPD-13397 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7918913 | Reaxys |
| Citations |
|---|