EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15N3O4 |
| Net Charge | 0 |
| Average Mass | 217.225 |
| Monoisotopic Mass | 217.10626 |
| SMILES | C[C@H]([NH3+])C(=O)N[C@@H](CCC(N)=O)C(=O)[O-] |
| InChI | InChI=1S/C8H15N3O4/c1-4(9)7(13)11-5(8(14)15)2-3-6(10)12/h4-5H,2-3,9H2,1H3,(H2,10,12)(H,11,13)(H,14,15)/t4-,5-/m0/s1 |
| InChIKey | HJCMDXDYPOUFDY-WHFBIAKZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Gln zwitterion (CHEBI:74387) is a dipeptide zwitterion (CHEBI:90799) |
| Ala-Gln zwitterion (CHEBI:74387) is tautomer of Ala-Gln (CHEBI:73788) |
| Incoming Relation(s) |
| Ala-Gln (CHEBI:73788) is tautomer of Ala-Gln zwitterion (CHEBI:74387) |
| IUPAC Name |
|---|
| (2S)-5-amino-2-{[(2S)-2-azaniumylpropanoyl]amino}-5-oxopentanoate |
| Synonyms | Source |
|---|---|
| alanylglutamine zwitterion | ChEBI |
| L-alanyl-L-glutamine zwitterion | ChEBI |
| L-Ala-L-Gln zwitterion | ChEBI |
| AQ zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| L-alanyl-L-glutamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-13403 | MetaCyc |