EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15N3O4 |
| Net Charge | 0 |
| Average Mass | 217.225 |
| Monoisotopic Mass | 217.10626 |
| SMILES | C[C@H](N)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C8H15N3O4/c1-4(9)7(13)11-5(8(14)15)2-3-6(10)12/h4-5H,2-3,9H2,1H3,(H2,10,12)(H,11,13)(H,14,15)/t4-,5-/m0/s1 |
| InChIKey | HJCMDXDYPOUFDY-WHFBIAKZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Gln (CHEBI:73788) has role metabolite (CHEBI:25212) |
| Ala-Gln (CHEBI:73788) is a dipeptide (CHEBI:46761) |
| Ala-Gln (CHEBI:73788) is tautomer of Ala-Gln zwitterion (CHEBI:74387) |
| Incoming Relation(s) |
| Ala-Gln zwitterion (CHEBI:74387) is tautomer of Ala-Gln (CHEBI:73788) |
| IUPAC Name |
|---|
| L-alanyl-L-glutamine |
| Synonyms | Source |
|---|---|
| AQ | ChEBI |
| L-Ala-L-Gln | ChEBI |
| alanylglutamine | ChEBI |
| Alanyl-Glutamine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028685 | HMDB |
| CPD-13403 | MetaCyc |
| 4319 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2417888 | Reaxys |
| CAS:39537-23-0 | ChemIDplus |
| Citations |
|---|