EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H21N3O6S |
| Net Charge | 0 |
| Average Mass | 347.393 |
| Monoisotopic Mass | 347.11511 |
| SMILES | COC(=O)/C=C/C(=O)NCC(NC(=O)[C@@H](N)CCSC)C(=O)O |
| InChI | InChI=1S/C13H21N3O6S/c1-22-11(18)4-3-10(17)15-7-9(13(20)21)16-12(19)8(14)5-6-23-2/h3-4,8-9H,5-7,14H2,1-2H3,(H,15,17)(H,16,19)(H,20,21)/b4-3+/t8-,9?/m0/s1 |
| InChIKey | HJYAHPUOQVTGHV-OSQTYMOCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Met-FMDP (CHEBI:74356) has functional parent L-methionine (CHEBI:16643) |
| Met-FMDP (CHEBI:74356) has functional parent 3-aminoalanine (CHEBI:18383) |
| Met-FMDP (CHEBI:74356) has role metabolite (CHEBI:25212) |
| Met-FMDP (CHEBI:74356) is a dipeptide (CHEBI:46761) |
| Met-FMDP (CHEBI:74356) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| L-methionyl-3-{[(2E)-4-methoxy-4-oxobut-2-enoyl]amino}alanine |
| Synonym | Source |
|---|---|
| 3-[3-(Methoxycarbonyl)prop-2-enoylamino]-2-((2S)-2-amino-4-methylthiobutanoylamino)propanoic acid | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD0-1908 | MetaCyc |