EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H74O8 |
| Net Charge | 0 |
| Average Mass | 659.002 |
| Monoisotopic Mass | 658.53837 |
| SMILES | CCCCCCCCCCCCCCCC(O)C(CCCCCCCCCCCCCC)C(=O)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C38H74O8/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-32(39)31(28-26-24-22-20-18-16-14-12-10-8-6-4-2)37(43)45-30-33-34(40)35(41)36(42)38(44)46-33/h31-36,38-42,44H,3-30H2,1-2H3/t31?,32?,33-,34-,35+,36-,38?/m1/s1 |
| InChIKey | AQVWXIRCPXPVPT-UNCJEZMPSA-N |
| Roles Classification |
|---|
| Biological Role: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-deoxy-D-glucos-6-yl corynomycolate (CHEBI:74256) has functional parent D-glucopyranose (CHEBI:4167) |
| 6-deoxy-D-glucos-6-yl corynomycolate (CHEBI:74256) has functional parent corynomycolic acid (CHEBI:60916) |
| 6-deoxy-D-glucos-6-yl corynomycolate (CHEBI:74256) has role antigen (CHEBI:59132) |
| 6-deoxy-D-glucos-6-yl corynomycolate (CHEBI:74256) is a mycolate ester (CHEBI:74253) |
| Incoming Relation(s) |
| 6-deoxy-D-glucos-6-yl (2R,3R)-corynomycolate (CHEBI:77816) is a 6-deoxy-D-glucos-6-yl corynomycolate (CHEBI:74256) |
| IUPAC Name |
|---|
| 6-O-(3-hydroxy-2-tetradecyloctadecanoyl)-D-glucopyranose |
| Synonyms | Source |
|---|---|
| glucose 6-O-monomycolate | ChEBI |
| C32 glucose MM | ChEBI |
| glucose monomycolate (C32) | ChEBI |
| glucose MM (C32) | ChEBI |
| C32 GMM | ChEBI |
| C32-GMM | ChEBI |
| Citations |
|---|