EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H64O3 |
| Net Charge | 0 |
| Average Mass | 496.861 |
| Monoisotopic Mass | 496.48555 |
| SMILES | CCCCCCCCCCCCCCCC(O)C(CCCCCCCCCCCCCC)C(=O)O |
| InChI | InChI=1S/C32H64O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31(33)30(32(34)35)28-26-24-22-20-18-16-14-12-10-8-6-4-2/h30-31,33H,3-29H2,1-2H3,(H,34,35) |
| InChIKey | CUEQHYJSSUSIFI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| corynomycolic acid (CHEBI:60916) is a 3-hydroxy fatty acid (CHEBI:59845) |
| corynomycolic acid (CHEBI:60916) is a mycolic acid (CHEBI:25438) |
| Incoming Relation(s) |
| 6-deoxy-D-glucos-6-yl corynomycolate (CHEBI:74256) has functional parent corynomycolic acid (CHEBI:60916) |
| IUPAC Name |
|---|
| 3-hydroxy-2-tetradecyloctadecanoic acid |
| Synonyms | Source |
|---|---|
| mycolic acid (C32) | ChEBI |
| synthetic mycolic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C16793 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1807083 | Reaxys |
| CAS:446-21-9 | KEGG COMPOUND |
| Citations |
|---|