EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42N7O19P3S |
| Net Charge | 0 |
| Average Mass | 881.641 |
| Monoisotopic Mass | 881.14690 |
| SMILES | CC[C@@H](C(=O)O)C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C26H42N7O19P3S/c1-4-13(24(38)39)25(40)56-8-7-28-15(34)5-6-29-22(37)19(36)26(2,3)10-49-55(46,47)52-54(44,45)48-9-14-18(51-53(41,42)43)17(35)23(50-14)33-12-32-16-20(27)30-11-31-21(16)33/h11-14,17-19,23,35-36H,4-10H2,1-3H3,(H,28,34)(H,29,37)(H,38,39)(H,44,45)(H,46,47)(H2,27,30,31)(H2,41,42,43)/t13-,14+,17+,18+,19-,23+/m0/s1 |
| InChIKey | VUGZQVCBBBEZQE-UQCJFRAESA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-ethylmalonyl-CoA (CHEBI:60907) has functional parent ethylmalonic acid (CHEBI:741548) |
| (S)-ethylmalonyl-CoA (CHEBI:60907) is a ω-carboxyacyl-CoA (CHEBI:37555) |
| (S)-ethylmalonyl-CoA (CHEBI:60907) is conjugate acid of (S)-ethylmalonyl-CoA(5−) (CHEBI:60909) |
| Incoming Relation(s) |
| (S)-ethylmalonyl-CoA(5−) (CHEBI:60909) is conjugate base of (S)-ethylmalonyl-CoA (CHEBI:60907) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-4-({3-[(2-{[(2S)-2-carboxybutanoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| (S)-2-ethylmalonyl-CoA | ChEBI |
| (S)-ethylmalonyl coenzyme A | ChEBI |
| (2S)-ethylmalonyl coenzyme A | ChEBI |
| (S)-ethylmalonyl-CoA | ChEBI |
| (2S)-2-ethylmalonyl-CoA | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19783652 | Reaxys |
| Citations |
|---|