EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19NO3 |
| Net Charge | 0 |
| Average Mass | 201.266 |
| Monoisotopic Mass | 201.13649 |
| SMILES | CCCCCCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C10H19NO3/c1-2-3-4-5-6-7-9(12)11-8-10(13)14/h2-8H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | SAVLIIGUQOSOEP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-octanoylglycine (CHEBI:74099) has functional parent glycine (CHEBI:15428) |
| N-octanoylglycine (CHEBI:74099) has functional parent octanoic acid (CHEBI:28837) |
| N-octanoylglycine (CHEBI:74099) has role metabolite (CHEBI:25212) |
| N-octanoylglycine (CHEBI:74099) is a N-acylglycine (CHEBI:16180) |
| N-octanoylglycine (CHEBI:74099) is a fatty amide (CHEBI:29348) |
| N-octanoylglycine (CHEBI:74099) is conjugate acid of N-octanoylglycinate (CHEBI:142681) |
| Incoming Relation(s) |
| N-octanoylglycinate (CHEBI:142681) is conjugate base of N-octanoylglycine (CHEBI:74099) |
| IUPAC Name |
|---|
| N-octanoylglycine |
| Synonyms | Source |
|---|---|
| 2-octanamidoacetic acid | HMDB |
| capryloylglycine | ChEBI |
| Caprylylglycine | HMDB |
| N-(1-Oxooctyl)glycine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| FDB022273 | FooDB |
| HMDB0000832 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2209293 | Reaxys |
| CAS:14246-53-8 | ChemIDplus |