EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO2S |
| Net Charge | 0 |
| Average Mass | 161.226 |
| Monoisotopic Mass | 161.05105 |
| SMILES | C=CCSC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H11NO2S/c1-2-3-10-4-5(7)6(8)9/h2,5H,1,3-4,7H2,(H,8,9)/t5-/m0/s1 |
| InChIKey | ZFAHNWWNDFHPOH-YFKPBYRVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-allylcysteine (CHEBI:74077) has role antineoplastic agent (CHEBI:35610) |
| S-allylcysteine (CHEBI:74077) has role metabolite (CHEBI:25212) |
| S-allylcysteine (CHEBI:74077) is a S-hydrocarbyl-L-cysteine (CHEBI:47913) |
| S-allylcysteine (CHEBI:74077) is tautomer of S-allylcysteine zwitterion (CHEBI:133648) |
| Incoming Relation(s) |
| S-allylcysteine zwitterion (CHEBI:133648) is tautomer of S-allylcysteine (CHEBI:74077) |
| IUPAC Name |
|---|
| S-prop-2-en-1-yl-L-cysteine |
| Synonyms | Source |
|---|---|
| S-allyl-L-cysteine | ChEBI |
| S-2-propenyl-L-cysteine | HMDB |
| L-deoxyalliin | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0034323 | HMDB |
| C16759 | KEGG COMPOUND |
| S-Allyl_cysteine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1722895 | Reaxys |
| CAS:21593-77-1 | ChemIDplus |
| CAS:21593-77-1 | KEGG COMPOUND |
| Citations |
|---|