EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO2S |
| Net Charge | 0 |
| Average Mass | 161.226 |
| Monoisotopic Mass | 161.05105 |
| SMILES | C=CCSC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H11NO2S/c1-2-3-10-4-5(7)6(8)9/h2,5H,1,3-4,7H2,(H,8,9)/t5-/m0/s1 |
| InChIKey | ZFAHNWWNDFHPOH-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-allylcysteine zwitterion (CHEBI:133648) has role metabolite (CHEBI:25212) |
| S-allylcysteine zwitterion (CHEBI:133648) is a L-α-amino acid zwitterion (CHEBI:59869) |
| S-allylcysteine zwitterion (CHEBI:133648) is tautomer of S-allylcysteine (CHEBI:74077) |
| Incoming Relation(s) |
| S-allylcysteine (CHEBI:74077) is tautomer of S-allylcysteine zwitterion (CHEBI:133648) |
| IUPAC Name |
|---|
| (2R)-2-azaniumyl-3-[(prop-2-en-1-yl)sulfanyl]propanoate |
| Synonyms | Source |
|---|---|
| Cys(All) zwitterion | ChEBI |
| S-2-propenyl-L-cysteine | ChEBI |
| S-allyl-L-cysteine zwitterion | ChEBI |
| L-deoxyalliin zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| S-allyl-L-cysteine | UniProt |