EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO3 |
| Net Charge | 0 |
| Average Mass | 145.158 |
| Monoisotopic Mass | 145.07389 |
| SMILES | O=C(O)C1CCC(O)CN1 |
| InChI | InChI=1S/C6H11NO3/c8-4-1-2-5(6(9)10)7-3-4/h4-5,7-8H,1-3H2,(H,9,10) |
| InChIKey | RKEYKDXXZCICFZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxypipecolic acid (CHEBI:74048) has functional parent pipecolic acid (CHEBI:17964) |
| 5-hydroxypipecolic acid (CHEBI:74048) has role metabolite (CHEBI:25212) |
| 5-hydroxypipecolic acid (CHEBI:74048) is a piperidinemonocarboxylic acid (CHEBI:26148) |
| Incoming Relation(s) |
| methyl 5-hydroxypiperidine-2-carboxylate (CHEBI:70844) has functional parent 5-hydroxypipecolic acid (CHEBI:74048) |
| IUPAC Name |
|---|
| 5-hydroxypiperidine-2-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:81661 | Reaxys |
| CAS:13096-31-6 | ChemIDplus |
| Citations |
|---|