EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13NO3 |
| Net Charge | 0 |
| Average Mass | 159.185 |
| Monoisotopic Mass | 159.08954 |
| SMILES | COC(=O)C1CCC(O)CN1 |
| InChI | InChI=1S/C7H13NO3/c1-11-7(10)6-3-2-5(9)4-8-6/h5-6,8-9H,2-4H2,1H3 |
| InChIKey | KKBQWQJVUYTRDO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 5-hydroxypiperidine-2-carboxylate (CHEBI:70844) has functional parent 5-hydroxypipecolic acid (CHEBI:74048) |
| methyl 5-hydroxypiperidine-2-carboxylate (CHEBI:70844) has role metabolite (CHEBI:25212) |
| methyl 5-hydroxypiperidine-2-carboxylate (CHEBI:70844) is a piperidinecarboxylate ester (CHEBI:48630) |
| methyl 5-hydroxypiperidine-2-carboxylate (CHEBI:70844) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| methyl 5-hydroxypiperidine-2-carboxylate |
| Citations |
|---|