EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H72O16 |
| Net Charge | 0 |
| Average Mass | 869.055 |
| Monoisotopic Mass | 868.48204 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O[C@@H]4O[C@H](CO)[C@@H](O[C@@H]5O[C@@H](C)[C@H](O)[C@@H](O)[C@H]5O)[C@H](O)[C@H]4O[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@]2([H])O[C@]3(CC[C@@H](C)CO3)[C@@H](C)[C@]12[H] |
| InChI | InChI=1S/C45H72O16/c1-19-9-14-45(54-18-19)20(2)30-28(61-45)16-27-25-8-7-23-15-24(10-12-43(23,5)26(25)11-13-44(27,30)6)57-42-39(60-41-36(52)34(50)32(48)22(4)56-41)37(53)38(29(17-46)58-42)59-40-35(51)33(49)31(47)21(3)55-40/h7,19-22,24-42,46-53H,8-18H2,1-6H3/t19-,20+,21+,22+,24+,25-,26+,27+,28+,29-,30+,31+,32+,33-,34-,35-,36-,37+,38-,39-,40+,41+,42-,43+,44+,45-/m1/s1 |
| InChIKey | VNONINPVFQTJOC-ZGXDEBHDSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. EC 1.14.18.1 (tyrosinase) inhibitor Any EC 1.14.18.* (oxidoreductase acting on paired donors, miscellaneous compound as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosinase (monophenol monooxygenase), EC 1.14.18.1, an enzyme that catalyses the oxidation of phenols (such as tyrosine) and is widespread in plants and animals. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dioscin (CHEBI:74023) has functional parent diosgenin (CHEBI:4629) |
| dioscin (CHEBI:74023) has parent hydride spirostan (CHEBI:26745) |
| dioscin (CHEBI:74023) has role anti-inflammatory agent (CHEBI:67079) |
| dioscin (CHEBI:74023) has role antifungal agent (CHEBI:35718) |
| dioscin (CHEBI:74023) has role antineoplastic agent (CHEBI:35610) |
| dioscin (CHEBI:74023) has role antiviral agent (CHEBI:22587) |
| dioscin (CHEBI:74023) has role apoptosis inducer (CHEBI:68495) |
| dioscin (CHEBI:74023) has role EC 1.14.18.1 (tyrosinase) inhibitor (CHEBI:59997) |
| dioscin (CHEBI:74023) has role hepatoprotective agent (CHEBI:62868) |
| dioscin (CHEBI:74023) has role metabolite (CHEBI:25212) |
| dioscin (CHEBI:74023) is a hexacyclic triterpenoid (CHEBI:70994) |
| dioscin (CHEBI:74023) is a spiroketal (CHEBI:72600) |
| dioscin (CHEBI:74023) is a spirostanyl glycoside (CHEBI:38091) |
| dioscin (CHEBI:74023) is a trisaccharide derivative (CHEBI:63571) |
| IUPAC Name |
|---|
| (25R)-spirost-5-en-3β-yl α-L-rhamnopyranosyl-(1→2)-[α-L-mannopyranosyl-(1→4)]-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 3-O-[α-L-Rha-(1→4)-[α-L-Rha-(1→2)]-β-D-Glc]-diosgenin | ChEBI |
| 3-O-[α-L-Rhap-(1→4)-[α-L-Rhap-(1→2)]-β-D-Glcp]-diosgenin | ChEBI |
| 3-O-(Rhaα1-4(Rhaα1-2)Glcβ)-(25R)-spirost-5-en-3β-ol | LIPID MAPS |
| Collettiside III | ChemIDplus |
| Dioscine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| dioscin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003575 | KNApSAcK |
| C08897 | KEGG COMPOUND |
| LMST01080053 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:77615 | Reaxys |
| CAS:19057-60-4 | ChemIDplus |
| CAS:19057-60-4 | KEGG COMPOUND |
| Citations |
|---|