EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O3 |
| Net Charge | 0 |
| Average Mass | 414.630 |
| Monoisotopic Mass | 414.31340 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@]2([H])O[C@]3(CC[C@@H](C)CO3)[C@@H](C)[C@]12[H] |
| InChI | InChI=1S/C27H42O3/c1-16-7-12-27(29-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(28)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28H,6-15H2,1-4H3/t16-,17+,19+,20-,21+,22+,23+,24+,25+,26+,27-/m1/s1 |
| InChIKey | WQLVFSAGQJTQCK-VKROHFNGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dioscorea (ncbitaxon:4672) | tuber (BTO:0001400) | PubMed (21391660) |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diosgenin (CHEBI:4629) has parent hydride spirostan (CHEBI:26745) |
| diosgenin (CHEBI:4629) has role antineoplastic agent (CHEBI:35610) |
| diosgenin (CHEBI:4629) has role antiviral agent (CHEBI:22587) |
| diosgenin (CHEBI:4629) has role apoptosis inducer (CHEBI:68495) |
| diosgenin (CHEBI:4629) has role metabolite (CHEBI:25212) |
| diosgenin (CHEBI:4629) is a 3β-sterol (CHEBI:35348) |
| diosgenin (CHEBI:4629) is a hexacyclic triterpenoid (CHEBI:70994) |
| diosgenin (CHEBI:4629) is a sapogenin (CHEBI:26606) |
| diosgenin (CHEBI:4629) is a spiroketal (CHEBI:72600) |
| Incoming Relation(s) |
| 26-desglucoprotodioscin (CHEBI:74026) has functional parent diosgenin (CHEBI:4629) |
| dioscin (CHEBI:74023) has functional parent diosgenin (CHEBI:4629) |
| diosgenin 3-O-β-D-glucoside (CHEBI:74020) has functional parent diosgenin (CHEBI:4629) |
| IUPAC Name |
|---|
| (3β,25R)-spirost-5-en-3-ol |
| Synonyms | Source |
|---|---|
| (20R,25R)-spirost-5-en-3β-ol | ChemIDplus |
| (25R)-spirost-5-en-3β-ol | ChemIDplus |
| nitogenin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| diosgenin | UniProt |
| Citations |
|---|