EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H25NO7S |
| Net Charge | 0 |
| Average Mass | 387.454 |
| Monoisotopic Mass | 387.13517 |
| SMILES | N[C@@H](CS[C@H](/C=C/C=C/C=C\CC(=O)O)[C@@H](O)CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H25NO7S/c18-12(17(24)25)11-26-14(13(19)7-6-10-16(22)23)8-4-2-1-3-5-9-15(20)21/h1-5,8,12-14,19H,6-7,9-11,18H2,(H,20,21)(H,22,23)(H,24,25)/b2-1+,5-3-,8-4+/t12-,13-,14+/m0/s1 |
| InChIKey | AKPPXGOSRLMJLI-PYYRFDPSSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14-carboxy-15,16,17,18,19,20-hexanor-leukotriene E3 (CHEBI:74019) has functional parent leukotriene E3 (CHEBI:74018) |
| 14-carboxy-15,16,17,18,19,20-hexanor-leukotriene E3 (CHEBI:74019) is a L-cysteine thioether (CHEBI:27532) |
| 14-carboxy-15,16,17,18,19,20-hexanor-leukotriene E3 (CHEBI:74019) is a icosanoid (CHEBI:23899) |
| 14-carboxy-15,16,17,18,19,20-hexanor-leukotriene E3 (CHEBI:74019) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 14-carboxy-15,16,17,18,19,20-hexanor-leukotriene E3 (CHEBI:74019) is a secondary alcohol (CHEBI:35681) |
| Synonyms | Source |
|---|---|
| 14-carboxy-15,16,17,18,19,20-hexanor-LTE3 | ChEBI |
| 14-carboxy-15,16,17,18,19,20-hexanor-LTE3 | ChEBI |
| 14-carboxy-hexanor-leukotriene E3 | ChEBI |
| 14-carboxy-hexanor-LTE3 | ChEBI |
| 14-carboxy-hexanor-LTE3 | ChEBI |
| Citations |
|---|