EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H39NO5S |
| Net Charge | 0 |
| Average Mass | 441.634 |
| Monoisotopic Mass | 441.25489 |
| SMILES | CCCCCCCC/C=C\C=C\C=C\[C@@H](SC[C@H](N)C(=O)O)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C23H39NO5S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-21(30-18-19(24)23(28)29)20(25)15-14-17-22(26)27/h9-13,16,19-21,25H,2-8,14-15,17-18,24H2,1H3,(H,26,27)(H,28,29)/b10-9-,12-11+,16-13+/t19-,20-,21+/m0/s1 |
| InChIKey | KRTWHKZMWCZCIK-VRZYSOTLSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leukotriene E3 (CHEBI:74018) is a L-cysteine thioether (CHEBI:27532) |
| leukotriene E3 (CHEBI:74018) is a amino dicarboxylic acid (CHEBI:36164) |
| leukotriene E3 (CHEBI:74018) is a leukotriene (CHEBI:25029) |
| leukotriene E3 (CHEBI:74018) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| leukotriene E3 (CHEBI:74018) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| 14-carboxy-15,16,17,18,19,20-hexanor-leukotriene E3 (CHEBI:74019) has functional parent leukotriene E3 (CHEBI:74018) |
| IUPAC Names |
|---|
| (5S,6R,7E,9E,11Z)-6-(L-cystein-S-yl)-5-hydroxyicosa-7,9,11-trienoic acid |
| (5S,6R,7E,9E,11Z)-6-{[(2R)-2-amino-2-carboxyethyl]sulfanyl}-5-hydroxyicosa-7,9,11-trienoic acid |
| Synonyms | Source |
|---|---|
| 14,15-dihydro-leukotriene E4 | ChEBI |
| 14,15-dihydro-LTE4 | ChEBI |
| LTE3 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002355 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5999071 | Reaxys |
| Citations |
|---|