EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14O9 |
| Net Charge | 0 |
| Average Mass | 314.246 |
| Monoisotopic Mass | 314.06378 |
| SMILES | O=C(O)c1ccccc1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H14O9/c14-7-8(15)10(12(19)20)22-13(9(7)16)21-6-4-2-1-3-5(6)11(17)18/h1-4,7-10,13-16H,(H,17,18)(H,19,20)/t7-,8-,9+,10-,13+/m0/s1 |
| InChIKey | JSCWDKKMLIQCMR-CDHFTJPESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-salicylate glucuronide (CHEBI:73961) has functional parent salicylic acid (CHEBI:16914) |
| 1-salicylate glucuronide (CHEBI:73961) has role metabolite (CHEBI:25212) |
| 1-salicylate glucuronide (CHEBI:73961) is a benzoic acids (CHEBI:22723) |
| 1-salicylate glucuronide (CHEBI:73961) is a β-D-glucosiduronic acid (CHEBI:15341) |
| 1-salicylate glucuronide (CHEBI:73961) is conjugate acid of 1-salicylate O-glucuronide(1-) (CHEBI:176976) |
| Incoming Relation(s) |
| 1-salicylate O-glucuronide(1-) (CHEBI:176976) is conjugate base of 1-salicylate glucuronide (CHEBI:73961) |
| IUPAC Name |
|---|
| 2-carboxyphenyl β-D-glucopyranosiduronic acid |
| Manual Xrefs | Databases |
|---|---|
| 2341148 | ChemSpider |
| FDB027465 | FooDB |
| HMDB0010313 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:42422 | Reaxys |
| CAS:7695-70-7 | ChemIDplus |
| Citations |
|---|