EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5ClO2 |
| Net Charge | 0 |
| Average Mass | 108.524 |
| Monoisotopic Mass | 107.99781 |
| SMILES | C[C@H](Cl)C(=O)O |
| InChI | InChI=1S/C3H5ClO2/c1-2(4)3(5)6/h2H,1H3,(H,5,6)/t2-/m0/s1 |
| InChIKey | GAWAYYRQGQZKCR-REOHCLBHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | neurotoxin A poison that interferes with the functions of the nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-chloropropanoic acid (CHEBI:73956) has functional parent propionic acid (CHEBI:30768) |
| (S)-2-chloropropanoic acid (CHEBI:73956) has role neurotoxin (CHEBI:50910) |
| (S)-2-chloropropanoic acid (CHEBI:73956) is a chlorocarboxylic acid (CHEBI:36685) |
| (S)-2-chloropropanoic acid (CHEBI:73956) is a monocarboxylic acid (CHEBI:25384) |
| (S)-2-chloropropanoic acid (CHEBI:73956) is conjugate acid of (S)-2-chloropropanoate (CHEBI:73934) |
| Incoming Relation(s) |
| (S)-2-chloropropanoate (CHEBI:73934) is conjugate base of (S)-2-chloropropanoic acid (CHEBI:73956) |
| IUPAC Name |
|---|
| (2S)-2-chloropropanoic acid |
| Synonyms | Source |
|---|---|
| alpha-L-Chloropropionic acid | ChemIDplus |
| (S)-2-chloropropionic acid | ChEBI |
| (S)-α-chloropropanoic acid | ChEBI |
| (S)-α-chloropropionic acid | ChEBI |
| L-2-Chloropropanoic acid | ChemIDplus |
| L-2-Chloropropionic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2-Chloropropionic_acid | Wikipedia |
| US5753495 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1720257 | Reaxys |
| CAS:29617-66-1 | NIST Chemistry WebBook |
| CAS:29617-66-1 | ChemIDplus |
| Citations |
|---|