EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H4ClO2 |
| Net Charge | -1 |
| Average Mass | 107.516 |
| Monoisotopic Mass | 106.99053 |
| SMILES | C[C@H](Cl)C(=O)[O-] |
| InChI | InChI=1S/C3H5ClO2/c1-2(4)3(5)6/h2H,1H3,(H,5,6)/p-1/t2-/m0/s1 |
| InChIKey | GAWAYYRQGQZKCR-REOHCLBHSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-chloropropanoate (CHEBI:73934) is a monocarboxylic acid anion (CHEBI:35757) |
| (S)-2-chloropropanoate (CHEBI:73934) is conjugate base of (S)-2-chloropropanoic acid (CHEBI:73956) |
| Incoming Relation(s) |
| (S)-2-chloropropanoic acid (CHEBI:73956) is conjugate acid of (S)-2-chloropropanoate (CHEBI:73934) |
| IUPAC Name |
|---|
| (2S)-2-chloropropanoate |
| Synonym | Source |
|---|---|
| (S)-2-chloropropionate | ChEBI |
| UniProt Name | Source |
|---|---|
| (S)-2-chloropropanoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3930579 | Reaxys |
| Citations |
|---|