EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2O3 |
| Net Charge | 0 |
| Average Mass | 222.244 |
| Monoisotopic Mass | 222.10044 |
| SMILES | NCC(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H14N2O3/c12-7-10(14)13-9(11(15)16)6-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,13,14)(H,15,16)/t9-/m0/s1 |
| InChIKey | JBCLFWXMTIKCCB-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-Phe (CHEBI:73912) has role metabolite (CHEBI:25212) |
| Gly-Phe (CHEBI:73912) is a dipeptide (CHEBI:46761) |
| Gly-Phe (CHEBI:73912) is enantiomer of Gly-Phe zwitterion (CHEBI:133047) |
| Incoming Relation(s) |
| Gly-Phe zwitterion (CHEBI:133047) is enantiomer of Gly-Phe (CHEBI:73912) |
| IUPAC Name |
|---|
| glycyl-L-phenylalanine |
| Synonyms | Source |
|---|---|
| N-glycyl-3-phenylalanine | ChemIDplus |
| GF | ChEBI |
| glycylphenylalanine | ChEBI |
| Glycyl-Phenylalanine | HMDB |
| Gly-L-Phe | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028848 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2279318 | Reaxys |
| CAS:3321-03-7 | ChemIDplus |