EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2O3 |
| Net Charge | 0 |
| Average Mass | 222.244 |
| Monoisotopic Mass | 222.10044 |
| SMILES | [NH3+]CC(=O)N[C@@H](Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C11H14N2O3/c12-7-10(14)13-9(11(15)16)6-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,13,14)(H,15,16)/t9-/m0/s1 |
| InChIKey | JBCLFWXMTIKCCB-VIFPVBQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | saliva (UBERON:0001836) | PubMed (22308371) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-Phe zwitterion (CHEBI:133047) has role human metabolite (CHEBI:77746) |
| Gly-Phe zwitterion (CHEBI:133047) is a dipeptide zwitterion (CHEBI:90799) |
| Gly-Phe zwitterion (CHEBI:133047) is enantiomer of Gly-Phe (CHEBI:73912) |
| Incoming Relation(s) |
| Gly-Phe (CHEBI:73912) is enantiomer of Gly-Phe zwitterion (CHEBI:133047) |
| IUPAC Name |
|---|
| (2S)-2-(2-azaniumylacetamido)-3-phenylpropanoate |
| Synonyms | Source |
|---|---|
| GF zwitterion | ChEBI |
| glycylphenylalanine zwitterion | ChEBI |
| glycyl-L-phenylalanine zwitterion | ChEBI |
| Gly-L-Phe zwitterion | ChEBI |