EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N5O3 |
| Net Charge | 0 |
| Average Mass | 321.381 |
| Monoisotopic Mass | 321.18009 |
| SMILES | N=C(N)NCCC[C@H](N)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H23N5O3/c16-11(7-4-8-19-15(17)18)13(21)20-12(14(22)23)9-10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9,16H2,(H,20,21)(H,22,23)(H4,17,18,19)/t11-,12-/m0/s1 |
| InChIKey | PQBHGSGQZSOLIR-RYUDHWBXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arg-Phe (CHEBI:73818) has role metabolite (CHEBI:25212) |
| Arg-Phe (CHEBI:73818) has role vasodilator agent (CHEBI:35620) |
| Arg-Phe (CHEBI:73818) is a dipeptide (CHEBI:46761) |
| Arg-Phe (CHEBI:73818) is conjugate base of Arg-Phe(1+) (CHEBI:189870) |
| Incoming Relation(s) |
| Arg-Phe(1+) (CHEBI:189870) is conjugate acid of Arg-Phe (CHEBI:73818) |
| IUPAC Name |
|---|
| L-arginyl-L-phenylalanine |
| Synonyms | Source |
|---|---|
| L-Arg-L-Phe | ChEBI |
| arginylphenylalanine | ChEBI |
| RF | ChEBI |
| Arginyl-Phenylalanine | HMDB |
| R-F | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028716 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2777024 | Reaxys |
| CAS:2047-13-4 | ChemIDplus |
| Citations |
|---|