EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24N5O3 |
| Net Charge | +1 |
| Average Mass | 322.389 |
| Monoisotopic Mass | 322.18737 |
| SMILES | NC(=[NH2+])NCCC[C@H]([NH3+])C(=O)N[C@@H](Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C15H23N5O3/c16-11(7-4-8-19-15(17)18)13(21)20-12(14(22)23)9-10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9,16H2,(H,20,21)(H,22,23)(H4,17,18,19)/p+1/t11-,12-/m0/s1 |
| InChIKey | PQBHGSGQZSOLIR-RYUDHWBXSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arg-Phe(1+) (CHEBI:189870) is a peptide cation (CHEBI:60194) |
| Arg-Phe(1+) (CHEBI:189870) is conjugate acid of Arg-Phe (CHEBI:73818) |
| Incoming Relation(s) |
| Arg-Phe (CHEBI:73818) is conjugate base of Arg-Phe(1+) (CHEBI:189870) |
| IUPAC Name |
|---|
| (2S)-2-{[(2S)-5-{[amino(iminio)methyl]amino}-2-azaniumylpentanoyl]amino}-3-phenylpropanoate |
| Synonyms | Source |
|---|---|
| R-F(1+) | SUBMITTER |
| L-Arg-L-Phe(1+) | SUBMITTER |
| arginylphenylalanine(1+) | SUBMITTER |
| L-arginyl-L-phenylalanine(1+) | ChEBI |
| L-arginyl-L-phenylalanine cation | ChEBI |
| RF(1+) | ChEBI |
| UniProt Name | Source |
|---|---|
| L-arginyl-L-phenylalanine | UniProt |
| Citations |
|---|